C13H18N4O — CID 106968865
5-(2-aminoethyl)-N-(4-propylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106968865) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(4-propylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-aminoethyl)-N-(4-propylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106968865 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-(2-aminoethyl)-N-(4-propylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCc1ccc(Nc2nnc(CCN)o2)cc1 |
| InChI | InChI=1S/C13H18N4O/c1-2-3-10-4-6-11(7-5-10)15-13-17-16-12(18-13)8-9-14/h4-7H,2-3,8-9,14H2,1H3,(H,15,17) |
| InChIKey | NCPWAMUZGZEWMM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |