C18H21N5O — CID 110456641
5-(5-aminopentyl)-N-(4-pyridin-4-ylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 110456641) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-(5-aminopentyl)-N-(4-pyridin-4-ylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(5-aminopentyl)-N-(4-pyridin-4-ylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 110456641 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 5-(5-aminopentyl)-N-(4-pyridin-4-ylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | NCCCCCc1nnc(Nc2ccc(-c3ccncc3)cc2)o1 |
| InChI | InChI=1S/C18H21N5O/c19-11-3-1-2-4-17-22-23-18(24-17)21-16-7-5-14(6-8-16)15-9-12-20-13-10-15/h5-10,12-13H,1-4,11,19H2,(H,21,23) |
| InChIKey | QHGSBIDFKIYFGK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|