C13H21ClN4OS — CID 154917493
5-(4-aminobutyl)-N-(1-thiophen-3-ylpropan-2-yl)-1,3,4-oxadiazol-2-amine;hydrochloride (PubChem CID 154917493) has the molecular formula C13H21ClN4OS and a molecular weight of 316.86 g/mol. Its IUPAC name is 5-(4-aminobutyl)-N-(1-thiophen-3-ylpropan-2-yl)-1,3,4-oxadiazol-2-amine;hydrochloride.
| Compound Name | 5-(4-aminobutyl)-N-(1-thiophen-3-ylpropan-2-yl)-1,3,4-oxadiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 154917493 |
| Molecular Formula | C13H21ClN4OS |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 5-(4-aminobutyl)-N-(1-thiophen-3-ylpropan-2-yl)-1,3,4-oxadiazol-2-amine;hydrochloride |
| SMILES | CC(Cc1ccsc1)Nc1nnc(CCCCN)o1.Cl |
| InChI | InChI=1S/C13H20N4OS.ClH/c1-10(8-11-5-7-19-9-11)15-13-17-16-12(18-13)4-2-3-6-14;/h5,7,9-10H,2-4,6,8,14H2,1H3,(H,15,17);1H |
| InChIKey | ULVJNJKYFREINU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|