C21H16IN3O2 — CID 10073364
N-(4-iodophenyl)-5-[(4-phenylphenoxy)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 10073364) has the molecular formula C21H16IN3O2 and a molecular weight of 469.28 g/mol. Its IUPAC name is N-(4-iodophenyl)-5-[(4-phenylphenoxy)methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(4-iodophenyl)-5-[(4-phenylphenoxy)methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 10073364 |
| Molecular Formula | C21H16IN3O2 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | N-(4-iodophenyl)-5-[(4-phenylphenoxy)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Ic1ccc(Nc2nnc(COc3ccc(-c4ccccc4)cc3)o2)cc1 |
| InChI | InChI=1S/C21H16IN3O2/c22-17-8-10-18(11-9-17)23-21-25-24-20(27-21)14-26-19-12-6-16(7-13-19)15-4-2-1-3-5-15/h1-13H,14H2,(H,23,25) |
| InChIKey | RGYSQKJMBNWWRF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|