C17H16N2O2 — CID 61027840
N-methyl-4-[(5-phenyl-1,3-oxazol-2-yl)methoxy]aniline (PubChem CID 61027840) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-methyl-4-[(5-phenyl-1,3-oxazol-2-yl)methoxy]aniline.
| Compound Name | N-methyl-4-[(5-phenyl-1,3-oxazol-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 61027840 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-methyl-4-[(5-phenyl-1,3-oxazol-2-yl)methoxy]aniline |
| SMILES | CNc1ccc(OCc2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-18-14-7-9-15(10-8-14)20-12-17-19-11-16(21-17)13-5-3-2-4-6-13/h2-11,18H,12H2,1H3 |
| InChIKey | ZELUOJYLARZZMF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|