C16H14ClN3O — CID 106957474
5-(1-chloroethyl)-N-(4-phenylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106957474) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is 5-(1-chloroethyl)-N-(4-phenylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-chloroethyl)-N-(4-phenylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106957474 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 5-(1-chloroethyl)-N-(4-phenylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(Cl)c1nnc(Nc2ccc(-c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C16H14ClN3O/c1-11(17)15-19-20-16(21-15)18-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-11H,1H3,(H,18,20) |
| InChIKey | YNKUSOKGHDCWHR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|