C10H8ClF2N3O — CID 106956850
5-(1-chloroethyl)-N-(2,3-difluorophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106956850) has the molecular formula C10H8ClF2N3O and a molecular weight of 259.64 g/mol. Its IUPAC name is 5-(1-chloroethyl)-N-(2,3-difluorophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-chloroethyl)-N-(2,3-difluorophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106956850 |
| Molecular Formula | C10H8ClF2N3O |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 5-(1-chloroethyl)-N-(2,3-difluorophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(Cl)c1nnc(Nc2cccc(F)c2F)o1 |
| InChI | InChI=1S/C10H8ClF2N3O/c1-5(11)9-15-16-10(17-9)14-7-4-2-3-6(12)8(7)13/h2-5H,1H3,(H,14,16) |
| InChIKey | KKBCTAZOFKZXQD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|