C8H6F2N4O — CID 103436713
2-N-(2,3-difluorophenyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103436713) has the molecular formula C8H6F2N4O and a molecular weight of 212.16 g/mol. Its IUPAC name is 2-N-(2,3-difluorophenyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(2,3-difluorophenyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103436713 |
| Molecular Formula | C8H6F2N4O |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-N-(2,3-difluorophenyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | Nc1nnc(Nc2cccc(F)c2F)o1 |
| InChI | InChI=1S/C8H6F2N4O/c9-4-2-1-3-5(6(4)10)12-8-14-13-7(11)15-8/h1-3H,(H2,11,13)(H,12,14) |
| InChIKey | OGZASUYAQVQXBK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |