C10H13N5O3S — CID 106966865
4-[[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]amino]benzenesulfonamide (PubChem CID 106966865) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-[[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106966865 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-[[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]amino]benzenesulfonamide |
| SMILES | CC(N)c1nnc(Nc2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C10H13N5O3S/c1-6(11)9-14-15-10(18-9)13-7-2-4-8(5-3-7)19(12,16)17/h2-6H,11H2,1H3,(H,13,15)(H2,12,16,17) |
| InChIKey | LVNNSAOUFGWTME-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |