C8H13N3O4S2 — CID 112684101
4-[1-(sulfamoylamino)ethyl]benzenesulfonamide (PubChem CID 112684101) has the molecular formula C8H13N3O4S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-[1-(sulfamoylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[1-(sulfamoylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112684101 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 4-[1-(sulfamoylamino)ethyl]benzenesulfonamide |
| SMILES | CC(NS(N)(=O)=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C8H13N3O4S2/c1-6(11-17(10,14)15)7-2-4-8(5-3-7)16(9,12)13/h2-6,11H,1H3,(H2,9,12,13)(H2,10,14,15) |
| InChIKey | UGMVBTJGCTZVAJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |