C9H12F2N2O4S2 — CID 43134164
4-[1-(difluoromethylsulfonylamino)ethyl]benzenesulfonamide (PubChem CID 43134164) has the molecular formula C9H12F2N2O4S2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[1-(difluoromethylsulfonylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[1-(difluoromethylsulfonylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43134164 |
| Molecular Formula | C9H12F2N2O4S2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-[1-(difluoromethylsulfonylamino)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)C(F)F)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H12F2N2O4S2/c1-6(13-19(16,17)9(10)11)7-2-4-8(5-3-7)18(12,14)15/h2-6,9,13H,1H3,(H2,12,14,15) |
| InChIKey | ZSMMCYHJXWKFGQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |