C12H21N3O4S2 — CID 114816628
4-[1-(2-methylpropylsulfamoylamino)ethyl]benzenesulfonamide (PubChem CID 114816628) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[1-(2-methylpropylsulfamoylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[1-(2-methylpropylsulfamoylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114816628 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-[1-(2-methylpropylsulfamoylamino)ethyl]benzenesulfonamide |
| SMILES | CC(C)CNS(=O)(=O)NC(C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-9(2)8-14-21(18,19)15-10(3)11-4-6-12(7-5-11)20(13,16)17/h4-7,9-10,14-15H,8H2,1-3H3,(H2,13,16,17) |
| InChIKey | FUPAKDUFYPVQGD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |