C14H15IN2O2S — CID 43773421
4-[1-(2-iodoanilino)ethyl]benzenesulfonamide (PubChem CID 43773421) has the molecular formula C14H15IN2O2S and a molecular weight of 402.26 g/mol. Its IUPAC name is 4-[1-(2-iodoanilino)ethyl]benzenesulfonamide.
| Compound Name | 4-[1-(2-iodoanilino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43773421 |
| Molecular Formula | C14H15IN2O2S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 4-[1-(2-iodoanilino)ethyl]benzenesulfonamide |
| SMILES | CC(Nc1ccccc1I)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H15IN2O2S/c1-10(17-14-5-3-2-4-13(14)15)11-6-8-12(9-7-11)20(16,18)19/h2-10,17H,1H3,(H2,16,18,19) |
| InChIKey | ZSDAIAJOBXEAHM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|