C8H10Cl2N2O2S — CID 112684116
1,2-dichloro-4-[1-(sulfamoylamino)ethyl]benzene (PubChem CID 112684116) has the molecular formula C8H10Cl2N2O2S and a molecular weight of 269.15 g/mol. Its IUPAC name is 1,2-dichloro-4-[1-(sulfamoylamino)ethyl]benzene.
| Compound Name | 1,2-dichloro-4-[1-(sulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 112684116 |
| Molecular Formula | C8H10Cl2N2O2S |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 1,2-dichloro-4-[1-(sulfamoylamino)ethyl]benzene |
| SMILES | CC(NS(N)(=O)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N2O2S/c1-5(12-15(11,13)14)6-2-3-7(9)8(10)4-6/h2-5,12H,1H3,(H2,11,13,14) |
| InChIKey | MRTZAIDMSBXDGA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |