C10H14Cl2N2O2S — CID 105281333
[1-(3,4-dichlorophenyl)-2-methylsulfonylpropyl]hydrazine (PubChem CID 105281333) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(3,4-dichlorophenyl)-2-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 105281333 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2-methylsulfonylpropyl]hydrazine |
| SMILES | CC(C(NN)c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-6(17(2,15)16)10(14-13)7-3-4-8(11)9(12)5-7/h3-6,10,14H,13H2,1-2H3 |
| InChIKey | OVOTTZSHCWHGIQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|