C12H13Cl2N3O2S — CID 61249472
N-[1-(3,4-dichlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 61249472) has the molecular formula C12H13Cl2N3O2S and a molecular weight of 334.23 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61249472 |
| Molecular Formula | C12H13Cl2N3O2S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N3O2S/c1-7(9-3-4-10(13)11(14)5-9)17-20(18,19)12-6-15-16-8(12)2/h3-7,17H,1-2H3,(H,15,16) |
| InChIKey | JTDNBYVYFKCPIW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |