C8H16N4O — CID 106966295
5-(aminomethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 106966295) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-(aminomethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(aminomethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106966295 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 5-(aminomethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | CCCC(C)Nc1nnc(CN)o1 |
| InChI | InChI=1S/C8H16N4O/c1-3-4-6(2)10-8-12-11-7(5-9)13-8/h6H,3-5,9H2,1-2H3,(H,10,12) |
| InChIKey | YLGYQOSXOURAKQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |