C15H22N2O4 — CID 106296660
3-(3-aminophenoxy)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide (PubChem CID 106296660) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-(3-aminophenoxy)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide.
| Compound Name | 3-(3-aminophenoxy)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
|---|---|
| PubChem CID | 106296660 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-(3-aminophenoxy)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
| SMILES | Nc1cccc(OCCC(=O)NC2(CO)CCOCC2)c1 |
| InChI | InChI=1S/C15H22N2O4/c16-12-2-1-3-13(10-12)21-7-4-14(19)17-15(11-18)5-8-20-9-6-15/h1-3,10,18H,4-9,11,16H2,(H,17,19) |
| InChIKey | DTQKGMKIDJCGNS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|