C11H19F3N2O3 — CID 106297204
N-[4-(aminomethyl)oxan-4-yl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 106297204) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is N-[4-(aminomethyl)oxan-4-yl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[4-(aminomethyl)oxan-4-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 106297204 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-[4-(aminomethyl)oxan-4-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | NCC1(NC(=O)CCOCC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C11H19F3N2O3/c12-11(13,14)8-19-4-1-9(17)16-10(7-15)2-5-18-6-3-10/h1-8,15H2,(H,16,17) |
| InChIKey | BDHSYRBPJYIJKX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|