C14H17N3O3 — CID 106297402
N-[4-(hydroxymethyl)oxan-4-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 106297402) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 106297402 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C14H17N3O3/c18-8-14(3-5-20-6-4-14)17-13(19)10-1-2-11-12(7-10)16-9-15-11/h1-2,7,9,18H,3-6,8H2,(H,15,16)(H,17,19) |
| InChIKey | GHMHLMIWYZMSME-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |