C14H16N2O3S — CID 104630575
N-[4-(hydroxymethyl)oxan-4-yl]-1,3-benzothiazole-6-carboxamide (PubChem CID 104630575) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 104630575 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H16N2O3S/c17-8-14(3-5-19-6-4-14)16-13(18)10-1-2-11-12(7-10)20-9-15-11/h1-2,7,9,17H,3-6,8H2,(H,16,18) |
| InChIKey | PFMFEFKYNVIDGS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |