About [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol
[4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol (PubChem CID 106297511) has the molecular formula C14H24BrN3O2
and a molecular weight of 346.27 g/mol. Its IUPAC name is [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol |
| PubChem CID | 106297511 |
| Molecular Formula | C14H24BrN3O2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol |
| SMILES | CCc1nn(CC)c(CNC2(CO)CCOCC2)c1Br |
| InChI | InChI=1S/C14H24BrN3O2/c1-3-11-13(15)12(18(4-2)17-11)9-16-14(10-19)5-7-20-8-6-14/h16,19H,3-10H2,1-2H3 |
| InChIKey | ICZBUNWVOUEWBH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol?
The IUPAC name of [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol (CID 106297511) is [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol.
What is the SMILES notation for [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol?
The canonical SMILES for [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol is CCc1nn(CC)c(CNC2(CO)CCOCC2)c1Br.
What is the InChIKey of [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol?
The InChIKey is ICZBUNWVOUEWBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24BrN3O2/c1-3-11-13(15)12(18(4-2)17-11)9-16-14(10-19)5-7-20-8-6-14/h16,19H,3-10H2,1-2H3.
What are the key properties of [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol?
[4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol has a molecular weight of 346.27 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol is sourced from PubChem (CID 106297511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).