C14H25N3O2 — CID 106297418
[4-[(1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol (PubChem CID 106297418) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is [4-[(1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol.
| Compound Name | [4-[(1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106297418 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | [4-[(1,3-diethylpyrazol-5-yl)methylamino]oxan-4-yl]methanol |
| SMILES | CCc1cc(CNC2(CO)CCOCC2)n(CC)n1 |
| InChI | InChI=1S/C14H25N3O2/c1-3-12-9-13(17(4-2)16-12)10-15-14(11-18)5-7-19-8-6-14/h9,15,18H,3-8,10-11H2,1-2H3 |
| InChIKey | QZNUYIWDBIMYAC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |