C14H19NO5S — CID 106298751
3-acetyl-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide (PubChem CID 106298751) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-acetyl-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 106298751 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-acetyl-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NC2(CO)CCOCC2)c1 |
| InChI | InChI=1S/C14H19NO5S/c1-11(17)12-3-2-4-13(9-12)21(18,19)15-14(10-16)5-7-20-8-6-14/h2-4,9,15-16H,5-8,10H2,1H3 |
| InChIKey | FHACQOUJRCQHKH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |