C12H19N3O5S — CID 106298992
4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 106298992) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106298992 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NC2(CO)CCOCC2)cc1C(N)=O |
| InChI | InChI=1S/C12H19N3O5S/c1-15-7-9(6-10(15)11(13)17)21(18,19)14-12(8-16)2-4-20-5-3-12/h6-7,14,16H,2-5,8H2,1H3,(H2,13,17) |
| InChIKey | BMWZWAOAANGOLC-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |