C10H18N4O4S — CID 106296705
5-amino-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylimidazole-4-sulfonamide (PubChem CID 106296705) has the molecular formula C10H18N4O4S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-amino-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylimidazole-4-sulfonamide.
| Compound Name | 5-amino-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 106296705 |
| Molecular Formula | C10H18N4O4S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-amino-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C10H18N4O4S/c1-14-7-12-8(11)9(14)19(16,17)13-10(6-15)2-4-18-5-3-10/h7,13,15H,2-6,11H2,1H3 |
| InChIKey | RPXJDSWEQJACCG-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |