C11H14ClNO2S — CID 106300315
N-[4-(chloromethyl)oxan-4-yl]thiophene-2-carboxamide (PubChem CID 106300315) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is N-[4-(chloromethyl)oxan-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[4-(chloromethyl)oxan-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106300315 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-[4-(chloromethyl)oxan-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1(CCl)CCOCC1)c1cccs1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-8-11(3-5-15-6-4-11)13-10(14)9-2-1-7-16-9/h1-2,7H,3-6,8H2,(H,13,14) |
| InChIKey | PSCFZPUQJVBOCS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|