C14H24N4O2 — CID 106301181
[4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]oxan-4-yl]methanol (PubChem CID 106301181) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]oxan-4-yl]methanol.
| Compound Name | [4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106301181 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]oxan-4-yl]methanol |
| SMILES | CNc1cc(NC2(CO)CCOCC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C14H24N4O2/c1-10(2)13-16-11(15-3)8-12(17-13)18-14(9-19)4-6-20-7-5-14/h8,10,19H,4-7,9H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | FWYMMIWUWBINDU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |