C11H22BrNO3S — CID 106301330
N-[4-(bromomethyl)oxan-4-yl]-2,2-dimethylpropane-1-sulfonamide (PubChem CID 106301330) has the molecular formula C11H22BrNO3S and a molecular weight of 328.27 g/mol. Its IUPAC name is N-[4-(bromomethyl)oxan-4-yl]-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | N-[4-(bromomethyl)oxan-4-yl]-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 106301330 |
| Molecular Formula | C11H22BrNO3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[4-(bromomethyl)oxan-4-yl]-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)NC1(CBr)CCOCC1 |
| InChI | InChI=1S/C11H22BrNO3S/c1-10(2,3)9-17(14,15)13-11(8-12)4-6-16-7-5-11/h13H,4-9H2,1-3H3 |
| InChIKey | OERJHGFFYGPQEL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|