C15H22ClNO3S — CID 106301359
N-[4-(chloromethyl)oxan-4-yl]-4-propylbenzenesulfonamide (PubChem CID 106301359) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is N-[4-(chloromethyl)oxan-4-yl]-4-propylbenzenesulfonamide.
| Compound Name | N-[4-(chloromethyl)oxan-4-yl]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 106301359 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[4-(chloromethyl)oxan-4-yl]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NC2(CCl)CCOCC2)cc1 |
| InChI | InChI=1S/C15H22ClNO3S/c1-2-3-13-4-6-14(7-5-13)21(18,19)17-15(12-16)8-10-20-11-9-15/h4-7,17H,2-3,8-12H2,1H3 |
| InChIKey | XRRDYXZFKNQREG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|