C14H21ClN2O3S — CID 106300134
4-[[4-(chloromethyl)oxan-4-yl]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 106300134) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 4-[[4-(chloromethyl)oxan-4-yl]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[4-(chloromethyl)oxan-4-yl]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106300134 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-[[4-(chloromethyl)oxan-4-yl]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC2(CCl)CCOCC2)cc1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-17(2)21(18,19)13-5-3-12(4-6-13)16-14(11-15)7-9-20-10-8-14/h3-6,16H,7-11H2,1-2H3 |
| InChIKey | CQSGXUWKGZBOTJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|