C12H22N6O3 — CID 106301508
[4-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]oxan-4-yl]methanol (PubChem CID 106301508) has the molecular formula C12H22N6O3 and a molecular weight of 298.35 g/mol. Its IUPAC name is [4-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]oxan-4-yl]methanol.
| Compound Name | [4-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106301508 |
| Molecular Formula | C12H22N6O3 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [4-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]oxan-4-yl]methanol |
| SMILES | CC(C)Oc1nc(NN)nc(NC2(CO)CCOCC2)n1 |
| InChI | InChI=1S/C12H22N6O3/c1-8(2)21-11-15-9(14-10(16-11)18-13)17-12(7-19)3-5-20-6-4-12/h8,19H,3-7,13H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | SQRIYJOVMWYCQI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|