C13H24N6O2 — CID 115366569
[1-[[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]methyl]cyclopentyl]methanol (PubChem CID 115366569) has the molecular formula C13H24N6O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is [1-[[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]methyl]cyclopentyl]methanol.
| Compound Name | [1-[[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 115366569 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [1-[[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]methyl]cyclopentyl]methanol |
| SMILES | CC(C)Oc1nc(NN)nc(NCC2(CO)CCCC2)n1 |
| InChI | InChI=1S/C13H24N6O2/c1-9(2)21-12-17-10(16-11(18-12)19-14)15-7-13(8-20)5-3-4-6-13/h9,20H,3-8,14H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | PLNAYUQRMVVXEF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|