About [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol
[3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol (PubChem CID 106303410) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol |
| PubChem CID | 106303410 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol |
| SMILES | CCn1cnnc1Cn1cncc1CO |
| InChI | InChI=1S/C9H13N5O/c1-2-13-7-11-12-9(13)4-14-6-10-3-8(14)5-15/h3,6-7,15H,2,4-5H2,1H3 |
| InChIKey | DVVFYLTWBKCDBZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
The IUPAC name of [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol (CID 106303410) is [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol.
What is the SMILES notation for [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
The canonical SMILES for [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol is CCn1cnnc1Cn1cncc1CO.
What is the InChIKey of [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
The InChIKey is DVVFYLTWBKCDBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-2-13-7-11-12-9(13)4-14-6-10-3-8(14)5-15/h3,6-7,15H,2,4-5H2,1H3.
What are the key properties of [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
[3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol has a molecular weight of 207.24 g/mol, XLogP of 0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol is sourced from PubChem (CID 106303410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).