C15H20BrNO4 — CID 106304782
N-[4-(bromomethyl)oxan-4-yl]-2,5-dimethoxybenzamide (PubChem CID 106304782) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is N-[4-(bromomethyl)oxan-4-yl]-2,5-dimethoxybenzamide.
| Compound Name | N-[4-(bromomethyl)oxan-4-yl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 106304782 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[4-(bromomethyl)oxan-4-yl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NC2(CBr)CCOCC2)c1 |
| InChI | InChI=1S/C15H20BrNO4/c1-19-11-3-4-13(20-2)12(9-11)14(18)17-15(10-16)5-7-21-8-6-15/h3-4,9H,5-8,10H2,1-2H3,(H,17,18) |
| InChIKey | NDPXKMYIXSLRBK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|