C15H20N2O4 — CID 106304934
2-ethyl-1-[3-(2-hydroxyethoxy)propyl]benzimidazole-4-carboxylic acid (PubChem CID 106304934) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-ethyl-1-[3-(2-hydroxyethoxy)propyl]benzimidazole-4-carboxylic acid.
| Compound Name | 2-ethyl-1-[3-(2-hydroxyethoxy)propyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106304934 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-ethyl-1-[3-(2-hydroxyethoxy)propyl]benzimidazole-4-carboxylic acid |
| SMILES | CCc1nc2c(C(=O)O)cccc2n1CCCOCCO |
| InChI | InChI=1S/C15H20N2O4/c1-2-13-16-14-11(15(19)20)5-3-6-12(14)17(13)7-4-9-21-10-8-18/h3,5-6,18H,2,4,7-10H2,1H3,(H,19,20) |
| InChIKey | ONUNLTBUZFTPNQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|