C13H13F3N2O2S — CID 106432165
2-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole-4-carboxylic acid (PubChem CID 106432165) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole-4-carboxylic acid.
| Compound Name | 2-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106432165 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole-4-carboxylic acid |
| SMILES | CCc1nc2c(C(=O)O)cccc2n1CCSC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O2S/c1-2-10-17-11-8(12(19)20)4-3-5-9(11)18(10)6-7-21-13(14,15)16/h3-5H,2,6-7H2,1H3,(H,19,20) |
| InChIKey | SPWDONYEAQRCDP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |