C14H21NO4S — CID 106305162
(2R,3S)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 106305162) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (2R,3S)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (2R,3S)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 106305162 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2R,3S)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C2C=CC(C2)[C@@H]1C(=O)NCCSCCCO |
| InChI | InChI=1S/C14H21NO4S/c16-5-1-6-20-7-4-15-13(17)11-9-2-3-10(8-9)12(11)14(18)19/h2-3,9-12,16H,1,4-8H2,(H,15,17)(H,18,19)/t9?,10?,11-,12+/m0/s1 |
| InChIKey | XJRAMMZIXZMVAJ-MMVSWEMESA-N |
| XLogP | 0.74 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|