C12H21NO4S — CID 106305169
cis-(1S,3R)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 106305169) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is cis-(1S,3R)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106305169 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | cis-(1S,3R)-3-[2-(3-hydroxypropylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H](C(=O)NCCSCCCO)C1 |
| InChI | InChI=1S/C12H21NO4S/c14-5-1-6-18-7-4-13-11(15)9-2-3-10(8-9)12(16)17/h9-10,14H,1-8H2,(H,13,15)(H,16,17)/t9-,10+/m1/s1 |
| InChIKey | XRIGGRKWEPXKCM-ZJUUUORDSA-N |
| XLogP | 0.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|