C12H16BrCl2NO — CID 106306137
N-[(4-bromo-2-chlorophenyl)methyl]-3-(2-chloroethoxy)propan-1-amine (PubChem CID 106306137) has the molecular formula C12H16BrCl2NO and a molecular weight of 341.08 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-3-(2-chloroethoxy)propan-1-amine.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-3-(2-chloroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 106306137 |
| Molecular Formula | C12H16BrCl2NO |
| Molecular Weight | 341.08 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-3-(2-chloroethoxy)propan-1-amine |
| SMILES | ClCCOCCCNCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H16BrCl2NO/c13-11-3-2-10(12(15)8-11)9-16-5-1-6-17-7-4-14/h2-3,8,16H,1,4-7,9H2 |
| InChIKey | VLHAKWXXNNVTRM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.08 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|