C4H7ClO3 — CID 10630616
2-[chloro(dideuterio)methyl]-3,3,3-trideuterio-2-hydroxypropanoic acid (PubChem CID 10630616) has the molecular formula C4H7ClO3 and a molecular weight of 143.58 g/mol. Its IUPAC name is 2-[chloro(dideuterio)methyl]-3,3,3-trideuterio-2-hydroxypropanoic acid.
| Compound Name | 2-[chloro(dideuterio)methyl]-3,3,3-trideuterio-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 10630616 |
| Molecular Formula | C4H7ClO3 |
| Molecular Weight | 143.58 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 2-[chloro(dideuterio)methyl]-3,3,3-trideuterio-2-hydroxypropanoic acid |
| SMILES | [2H]C([2H])([2H])C(O)(C(=O)O)C([2H])([2H])Cl |
| InChI | InChI=1S/C4H7ClO3/c1-4(8,2-5)3(6)7/h8H,2H2,1H3,(H,6,7)/i1D3,2D2 |
| InChIKey | NFSVYGUHJOOEJQ-ZBJDZAJPSA-N |
| XLogP | 0.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.58 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|