3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid

C4H8O3 — CID 10486812

IUPAC3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid
SMILES[2H]C([2H])([2H])C(O)(C(=O)O)C([2H])([2H])[2H]
InChIInChI=1S/C4H8O3/c1-4(2,7)3(5)6/h7H,1-2H3,(H,5,6)/i1D3,2D3
InChIKeyBWLBGMIXKSTLSX-WFGJKAKNSA-N
MW110.14 g/mol
LogP-0.16
Rot. Bonds3

About 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid

3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid (PubChem CID 10486812) has the molecular formula C4H8O3 and a molecular weight of 110.14 g/mol. Its IUPAC name is 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid.

Molecular Properties

Compound Name3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid
PubChem CID10486812
Molecular FormulaC4H8O3
Molecular Weight110.14 g/mol
Exact Mass110.09
IUPAC Name3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid
SMILES[2H]C([2H])([2H])C(O)(C(=O)O)C([2H])([2H])[2H]
InChIInChI=1S/C4H8O3/c1-4(2,7)3(5)6/h7H,1-2H3,(H,5,6)/i1D3,2D3
InChIKeyBWLBGMIXKSTLSX-WFGJKAKNSA-N
XLogP-0.16
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500110.14
LogP ≤ 5-0.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid?
The IUPAC name of 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid (CID 10486812) is 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid.
What is the SMILES notation for 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid?
The canonical SMILES for 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid is [2H]C([2H])([2H])C(O)(C(=O)O)C([2H])([2H])[2H].
What is the InChIKey of 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid?
The InChIKey is BWLBGMIXKSTLSX-WFGJKAKNSA-N. The full InChI is InChI=1S/C4H8O3/c1-4(2,7)3(5)6/h7H,1-2H3,(H,5,6)/i1D3,2D3.
What are the key properties of 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid?
3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid has a molecular weight of 110.14 g/mol, XLogP of -0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propanoic acid is sourced from PubChem (CID 10486812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).