C10H20BrNO3 — CID 106309578
2-bromo-N-[3-(2-hydroxyethoxy)propyl]-3-methylbutanamide (PubChem CID 106309578) has the molecular formula C10H20BrNO3 and a molecular weight of 282.18 g/mol. Its IUPAC name is 2-bromo-N-[3-(2-hydroxyethoxy)propyl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[3-(2-hydroxyethoxy)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106309578 |
| Molecular Formula | C10H20BrNO3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-bromo-N-[3-(2-hydroxyethoxy)propyl]-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)NCCCOCCO |
| InChI | InChI=1S/C10H20BrNO3/c1-8(2)9(11)10(14)12-4-3-6-15-7-5-13/h8-9,13H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | LNXFGQCVTWJBBQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|