C9H18N2O5 — CID 106310522
3-amino-4-[3-(2-hydroxyethoxy)propylamino]-4-oxobutanoic acid (PubChem CID 106310522) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-amino-4-[3-(2-hydroxyethoxy)propylamino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[3-(2-hydroxyethoxy)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106310522 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-amino-4-[3-(2-hydroxyethoxy)propylamino]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NCCCOCCO |
| InChI | InChI=1S/C9H18N2O5/c10-7(6-8(13)14)9(15)11-2-1-4-16-5-3-12/h7,12H,1-6,10H2,(H,11,15)(H,13,14) |
| InChIKey | SOBSJWXUTFDTON-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|