C10H18O2 — CID 10630996
(E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]hept-2-en-1-ol (PubChem CID 10630996) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]hept-2-en-1-ol.
| Compound Name | (E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]hept-2-en-1-ol |
|---|---|
| PubChem CID | 10630996 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]hept-2-en-1-ol |
| SMILES | CCCC/C=C/[C@H](O)[C@H]1O[C@H]1C |
| InChI | InChI=1S/C10H18O2/c1-3-4-5-6-7-9(11)10-8(2)12-10/h6-11H,3-5H2,1-2H3/b7-6+/t8-,9-,10-/m0/s1 |
| InChIKey | ZXHVSMUWUCCTHV-WQPYABEOSA-N |
| XLogP | 1.88 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|