C10H21NO2S — CID 106310200
trans-(1S,2S)-2-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclopentan-1-ol (PubChem CID 106310200) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106310200 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | trans-(1S,2S)-2-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclopentan-1-ol |
| SMILES | OCCCSCCN[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C10H21NO2S/c12-6-2-7-14-8-5-11-9-3-1-4-10(9)13/h9-13H,1-8H2/t9-,10-/m0/s1 |
| InChIKey | YIUAFKBEPGRZOV-UWVGGRQHSA-N |
| XLogP | 0.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|