About 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine
1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine (PubChem CID 106313152) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine |
| PubChem CID | 106313152 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(C(N)CNCC(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C17H30N2/c1-12(2)16(13(3)4)10-19-11-17(18)15-8-6-14(5)7-9-15/h6-9,12-13,16-17,19H,10-11,18H2,1-5H3 |
| InChIKey | OBEOVEZKCIRUQD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine?
The IUPAC name of 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine (CID 106313152) is 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine.
What is the SMILES notation for 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine?
The canonical SMILES for 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine is Cc1ccc(C(N)CNCC(C(C)C)C(C)C)cc1.
What is the InChIKey of 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine?
The InChIKey is OBEOVEZKCIRUQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2/c1-12(2)16(13(3)4)10-19-11-17(18)15-8-6-14(5)7-9-15/h6-9,12-13,16-17,19H,10-11,18H2,1-5H3.
What are the key properties of 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine?
1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine has a molecular weight of 262.44 g/mol, XLogP of 3.51, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-N'-(3-methyl-2-propan-2-ylbutyl)ethane-1,2-diamine is sourced from PubChem (CID 106313152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).