C11H18N2O — CID 163787468
(1R)-N'-ethoxy-1-(4-methylphenyl)ethane-1,2-diamine (PubChem CID 163787468) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (1R)-N'-ethoxy-1-(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-N'-ethoxy-1-(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 163787468 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (1R)-N'-ethoxy-1-(4-methylphenyl)ethane-1,2-diamine |
| SMILES | CCONC[C@H](N)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H18N2O/c1-3-14-13-8-11(12)10-6-4-9(2)5-7-10/h4-7,11,13H,3,8,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | MTTYITSACMDLBB-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|