C14H21F3N2O3S — CID 162555446
N-[3-(ethoxyamino)-2-(4-methylphenyl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide (PubChem CID 162555446) has the molecular formula C14H21F3N2O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is N-[3-(ethoxyamino)-2-(4-methylphenyl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide.
| Compound Name | N-[3-(ethoxyamino)-2-(4-methylphenyl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 162555446 |
| Molecular Formula | C14H21F3N2O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[3-(ethoxyamino)-2-(4-methylphenyl)propyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
| SMILES | CCONCC(CN(C)S(=O)(=O)C(F)(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21F3N2O3S/c1-4-22-18-9-13(12-7-5-11(2)6-8-12)10-19(3)23(20,21)14(15,16)17/h5-8,13,18H,4,9-10H2,1-3H3 |
| InChIKey | AKMCEDDGWDDSLK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|