C15H20F3N3O2 — CID 94219164
N-[(2S)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 94219164) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 94219164 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | Cc1ccc([C@@H](CNC(=O)C(=O)NCC(F)(F)F)N(C)C)cc1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-10-4-6-11(7-5-10)12(21(2)3)8-19-13(22)14(23)20-9-15(16,17)18/h4-7,12H,8-9H2,1-3H3,(H,19,22)(H,20,23)/t12-/m1/s1 |
| InChIKey | RASCYQWJXOJWIS-GFCCVEGCSA-N |
| XLogP | 1.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|